C21H20N8O — CID 51494017
[(3R)-3-(4-pyridin-4-yl-1H-pyrazol-5-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 51494017) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is [(3R)-3-(4-pyridin-4-yl-1H-pyrazol-5-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [(3R)-3-(4-pyridin-4-yl-1H-pyrazol-5-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 51494017 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(3R)-3-(4-pyridin-4-yl-1H-pyrazol-5-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CCC[C@@H](c2[nH]ncc2-c2ccncc2)C1 |
| InChI | InChI=1S/C21H20N8O/c30-21(16-3-1-5-18(11-16)29-14-24-26-27-29)28-10-2-4-17(13-28)20-19(12-23-25-20)15-6-8-22-9-7-15/h1,3,5-9,11-12,14,17H,2,4,10,13H2,(H,23,25)/t17-/m1/s1 |
| InChIKey | VQQIOEVVAOJRPB-QGZVFWFLSA-N |
| XLogP | 2.47 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |