C25H32N2O4 — CID 51497034
N-[(3-methyl-1H-indol-2-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine (PubChem CID 51497034) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[(3-methyl-1H-indol-2-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine.
| Compound Name | N-[(3-methyl-1H-indol-2-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 51497034 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-[(3-methyl-1H-indol-2-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1ccc(CN(Cc2[nH]c3ccccc3c2C)C[C@H]2CCCO2)c(OC)c1OC |
| InChI | InChI=1S/C25H32N2O4/c1-17-20-9-5-6-10-21(20)26-22(17)16-27(15-19-8-7-13-31-19)14-18-11-12-23(28-2)25(30-4)24(18)29-3/h5-6,9-12,19,26H,7-8,13-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | SENUVFBVUYYHDB-LJQANCHMSA-N |
| XLogP | 4.68 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|