C25H31FN2O4 — CID 46954458
N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-(oxolan-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine (PubChem CID 46954458) has the molecular formula C25H31FN2O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-(oxolan-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine.
| Compound Name | N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-(oxolan-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 46954458 |
| Molecular Formula | C25H31FN2O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-1-(oxolan-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1ccc(CN(Cc2[nH]c3ccc(F)cc3c2C)CC2CCCO2)c(OC)c1OC |
| InChI | InChI=1S/C25H31FN2O4/c1-16-20-12-18(26)8-9-21(20)27-22(16)15-28(14-19-6-5-11-32-19)13-17-7-10-23(29-2)25(31-4)24(17)30-3/h7-10,12,19,27H,5-6,11,13-15H2,1-4H3 |
| InChIKey | GUEHJZSSWCASIZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|