C20H24FNO3 — CID 51497042
5-[[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenol (PubChem CID 51497042) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 5-[[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 51497042 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 5-[[(4-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CN(Cc2ccc(F)cc2)C[C@@H]2CCCO2)cc1O |
| InChI | InChI=1S/C20H24FNO3/c1-24-20-9-6-16(11-19(20)23)13-22(14-18-3-2-10-25-18)12-15-4-7-17(21)8-5-15/h4-9,11,18,23H,2-3,10,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | DPPBGYIFDFNOIS-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |