C20H24N2O4 — CID 99946914
2-methoxy-5-[[[(2R)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)amino]methyl]benzoic acid (PubChem CID 99946914) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-methoxy-5-[[[(2R)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)amino]methyl]benzoic acid.
| Compound Name | 2-methoxy-5-[[[(2R)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 99946914 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-methoxy-5-[[[(2R)-oxolan-2-yl]methyl-(pyridin-4-ylmethyl)amino]methyl]benzoic acid |
| SMILES | COc1ccc(CN(Cc2ccncc2)C[C@H]2CCCO2)cc1C(=O)O |
| InChI | InChI=1S/C20H24N2O4/c1-25-19-5-4-16(11-18(19)20(23)24)13-22(14-17-3-2-10-26-17)12-15-6-8-21-9-7-15/h4-9,11,17H,2-3,10,12-14H2,1H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | MHNUAYWXNSGHGZ-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |