C23H25NO4 — CID 51497390
3-[[(2-methoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]chromen-4-one (PubChem CID 51497390) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[[(2-methoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]chromen-4-one.
| Compound Name | 3-[[(2-methoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]chromen-4-one |
|---|---|
| PubChem CID | 51497390 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[[(2-methoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]chromen-4-one |
| SMILES | COc1ccccc1CN(Cc1coc2ccccc2c1=O)C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H25NO4/c1-26-21-10-4-2-7-17(21)13-24(15-19-8-6-12-27-19)14-18-16-28-22-11-5-3-9-20(22)23(18)25/h2-5,7,9-11,16,19H,6,8,12-15H2,1H3/t19-/m1/s1 |
| InChIKey | OMVCFPYWQHIKKK-LJQANCHMSA-N |
| XLogP | 3.98 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |