C19H26N2O4 — CID 51497838
2-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-[(3R)-oxan-3-yl]acetamide (PubChem CID 51497838) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-[(3R)-oxan-3-yl]acetamide.
| Compound Name | 2-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-[(3R)-oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 51497838 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-[(3R)-oxan-3-yl]acetamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(CC(=O)N[C@@H]1CCCOC1)C(=O)CO2 |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,3)13-6-7-16-15(9-13)21(18(23)12-25-16)10-17(22)20-14-5-4-8-24-11-14/h6-7,9,14H,4-5,8,10-12H2,1-3H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | VPAINYUWKMJVCS-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |