C22H32N2O3 — CID 42787942
4-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclohexylbutanamide (PubChem CID 42787942) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclohexylbutanamide.
| Compound Name | 4-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 42787942 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclohexylbutanamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(CCCC(=O)NC1CCCCC1)C(=O)CO2 |
| InChI | InChI=1S/C22H32N2O3/c1-22(2,3)16-11-12-19-18(14-16)24(21(26)15-27-19)13-7-10-20(25)23-17-8-5-4-6-9-17/h11-12,14,17H,4-10,13,15H2,1-3H3,(H,23,25) |
| InChIKey | IWKHZUTVTFPDOZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |