C25H31N3O3 — CID 42788025
N-(1-benzylpiperidin-4-yl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide (PubChem CID 42788025) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide |
|---|---|
| PubChem CID | 42788025 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide |
| SMILES | Cc1ccc2c(c1)N(CCCC(=O)NC1CCN(Cc3ccccc3)CC1)C(=O)CO2 |
| InChI | InChI=1S/C25H31N3O3/c1-19-9-10-23-22(16-19)28(25(30)18-31-23)13-5-8-24(29)26-21-11-14-27(15-12-21)17-20-6-3-2-4-7-20/h2-4,6-7,9-10,16,21H,5,8,11-15,17-18H2,1H3,(H,26,29) |
| InChIKey | GFUSNVSMTBZYFO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |