C27H28N2O3 — CID 5047623
N-(1,2-diphenylethyl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide (PubChem CID 5047623) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide.
| Compound Name | N-(1,2-diphenylethyl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide |
|---|---|
| PubChem CID | 5047623 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-(1,2-diphenylethyl)-4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)butanamide |
| SMILES | Cc1ccc2c(c1)N(CCCC(=O)NC(Cc1ccccc1)c1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C27H28N2O3/c1-20-14-15-25-24(17-20)29(27(31)19-32-25)16-8-13-26(30)28-23(22-11-6-3-7-12-22)18-21-9-4-2-5-10-21/h2-7,9-12,14-15,17,23H,8,13,16,18-19H2,1H3,(H,28,30) |
| InChIKey | OWNLDCZIPIHTHE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |