C33H39N3O3 — CID 4640170
4-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-tert-butyl-1,4-benzoxazin-3-one (PubChem CID 4640170) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 4-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-tert-butyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-tert-butyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 4640170 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 4-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-tert-butyl-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)c1ccc2c(c1)N(CCCC(=O)N1CCN(C(c3ccccc3)c3ccccc3)CC1)C(=O)CO2 |
| InChI | InChI=1S/C33H39N3O3/c1-33(2,3)27-16-17-29-28(23-27)36(31(38)24-39-29)18-10-15-30(37)34-19-21-35(22-20-34)32(25-11-6-4-7-12-25)26-13-8-5-9-14-26/h4-9,11-14,16-17,23,32H,10,15,18-22,24H2,1-3H3 |
| InChIKey | VYQFBOGQVHXWTN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |