C18H24N2O2 — CID 51497863
(3R)-3-(1H-indol-3-yl)-N-[(3R)-oxan-3-yl]pentanamide (PubChem CID 51497863) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R)-3-(1H-indol-3-yl)-N-[(3R)-oxan-3-yl]pentanamide.
| Compound Name | (3R)-3-(1H-indol-3-yl)-N-[(3R)-oxan-3-yl]pentanamide |
|---|---|
| PubChem CID | 51497863 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3R)-3-(1H-indol-3-yl)-N-[(3R)-oxan-3-yl]pentanamide |
| SMILES | CC[C@H](CC(=O)N[C@@H]1CCCOC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H24N2O2/c1-2-13(10-18(21)20-14-6-5-9-22-12-14)16-11-19-17-8-4-3-7-15(16)17/h3-4,7-8,11,13-14,19H,2,5-6,9-10,12H2,1H3,(H,20,21)/t13-,14-/m1/s1 |
| InChIKey | QFRKNHBHUSLQMX-ZIAGYGMSSA-N |
| XLogP | 3.35 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |