C19H25N3O3 — CID 51497908
(2R)-N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 51497908) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | (2R)-N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 51497908 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2R)-N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | C[C@H](C(=O)N[C@H](C)c1ccc2c(c1)CCC2)N1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-11(14-9-8-13-6-5-7-15(13)10-14)20-16(23)12(2)22-17(24)19(3,4)21-18(22)25/h8-12H,5-7H2,1-4H3,(H,20,23)(H,21,25)/t11-,12-/m1/s1 |
| InChIKey | VQOKUZCUXWGSLG-VXGBXAGGSA-N |
| XLogP | 2.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|