C18H32N2+2 — CID 5149923
1,4-bis(but-2-enyl)-1,4-bis(prop-2-enyl)piperazine-1,4-diium (PubChem CID 5149923) has the molecular formula C18H32N2+2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 1,4-bis(but-2-enyl)-1,4-bis(prop-2-enyl)piperazine-1,4-diium.
| Compound Name | 1,4-bis(but-2-enyl)-1,4-bis(prop-2-enyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 5149923 |
| Molecular Formula | C18H32N2+2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1,4-bis(but-2-enyl)-1,4-bis(prop-2-enyl)piperazine-1,4-diium |
| SMILES | C=CC[N+]1(CC=CC)CC[N+](CC=C)(CC=CC)CC1 |
| InChI | InChI=1S/C18H32N2/c1-5-9-13-19(11-7-3)15-17-20(12-8-4,18-16-19)14-10-6-2/h5-10H,3-4,11-18H2,1-2H3/q+2 |
| InChIKey | NQVNNVPRLQBYOC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|