C9H17N2+ — CID 69185533
1,1-bis(prop-2-enyl)imidazolidin-1-ium (PubChem CID 69185533) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is 1,1-bis(prop-2-enyl)imidazolidin-1-ium.
| Compound Name | 1,1-bis(prop-2-enyl)imidazolidin-1-ium |
|---|---|
| PubChem CID | 69185533 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 1,1-bis(prop-2-enyl)imidazolidin-1-ium |
| SMILES | C=CC[N+]1(CC=C)CCNC1 |
| InChI | InChI=1S/C9H17N2/c1-3-6-11(7-4-2)8-5-10-9-11/h3-4,10H,1-2,5-9H2/q+1 |
| InChIKey | MFKGOTRKDIIZAN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|