C15H20BrN — CID 15551879
2,2-bis(prop-2-enyl)-3,4-dihydro-1H-isoquinolin-2-ium bromide (PubChem CID 15551879) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)-3,4-dihydro-1H-isoquinolin-2-ium bromide.
| Compound Name | 2,2-bis(prop-2-enyl)-3,4-dihydro-1H-isoquinolin-2-ium bromide |
|---|---|
| PubChem CID | 15551879 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2,2-bis(prop-2-enyl)-3,4-dihydro-1H-isoquinolin-2-ium bromide |
| SMILES | C=CC[N+]1(CC=C)CCc2ccccc2C1.[Br-] |
| InChI | InChI=1S/C15H20N.BrH/c1-3-10-16(11-4-2)12-9-14-7-5-6-8-15(14)13-16;/h3-8H,1-2,9-13H2;1H/q+1;/p-1 |
| InChIKey | RWTAJDJMNNNFLC-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|