C20H27NO3S — CID 51500136
(4S)-4-ethyl-5-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 51500136) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is (4S)-4-ethyl-5-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | (4S)-4-ethyl-5-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 51500136 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (4S)-4-ethyl-5-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CC[C@H]1c2ccsc2CCN1Cc1ccc(OC)c(OCCOC)c1 |
| InChI | InChI=1S/C20H27NO3S/c1-4-17-16-8-12-25-20(16)7-9-21(17)14-15-5-6-18(23-3)19(13-15)24-11-10-22-2/h5-6,8,12-13,17H,4,7,9-11,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | QRVYKBPVWIKCML-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|