C19H25NO2S — CID 51593965
(4R)-4-ethyl-5-[[3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 51593965) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is (4R)-4-ethyl-5-[[3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | (4R)-4-ethyl-5-[[3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 51593965 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (4R)-4-ethyl-5-[[3-(2-methoxyethoxy)phenyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CC[C@@H]1c2ccsc2CCN1Cc1cccc(OCCOC)c1 |
| InChI | InChI=1S/C19H25NO2S/c1-3-18-17-8-12-23-19(17)7-9-20(18)14-15-5-4-6-16(13-15)22-11-10-21-2/h4-6,8,12-13,18H,3,7,9-11,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | MJHDXHCGSGLKMX-GOSISDBHSA-N |
| XLogP | 4.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|