About bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+)
bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) (PubChem CID 5150220) has the molecular formula C8H20N4NiO2-2
and a molecular weight of 262.97 g/mol. Its IUPAC name is bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+).
Molecular Properties
| Compound Name | bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) |
| PubChem CID | 5150220 |
| Molecular Formula | C8H20N4NiO2-2 |
| Molecular Weight | 262.97 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) |
| SMILES | [NH-]CC[N-]CCO.[NH-]CC[N-]CCO.[Ni+2] |
| InChI | InChI=1S/2C4H10N2O.Ni/c2*5-1-2-6-3-4-7;/h2*5,7H,1-4H2;/q2*-2;+2 |
| InChIKey | PSSLPCNVFLDJGD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.97 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+)?
The IUPAC name of bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) (CID 5150220) is bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+).
What is the SMILES notation for bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+)?
The canonical SMILES for bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) is [NH-]CC[N-]CCO.[NH-]CC[N-]CCO.[Ni+2].
What is the InChIKey of bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+)?
The InChIKey is PSSLPCNVFLDJGD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2O.Ni/c2*5-1-2-6-3-4-7;/h2*5,7H,1-4H2;/q2*-2;+2.
What are the key properties of bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+)?
bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) has a molecular weight of 262.97 g/mol, XLogP of 0.81, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azanidylethyl(2-hydroxyethyl)azanide);nickel(2+) is sourced from PubChem (CID 5150220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).