About bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+)
bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) (PubChem CID 4026477) has the molecular formula C8H22CoN4O2
and a molecular weight of 265.22 g/mol. Its IUPAC name is bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+).
Molecular Properties
| Compound Name | bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) |
| PubChem CID | 4026477 |
| Molecular Formula | C8H22CoN4O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) |
| SMILES | NCC[N-]CCO.NCC[N-]CCO.[Co+2] |
| InChI | InChI=1S/2C4H11N2O.Co/c2*5-1-2-6-3-4-7;/h2*7H,1-5H2;/q2*-1;+2 |
| InChIKey | AVQIBNVUQOPIBO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+)?
The IUPAC name of bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) (CID 4026477) is bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+).
What is the SMILES notation for bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+)?
The canonical SMILES for bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) is NCC[N-]CCO.NCC[N-]CCO.[Co+2].
What is the InChIKey of bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+)?
The InChIKey is AVQIBNVUQOPIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11N2O.Co/c2*5-1-2-6-3-4-7;/h2*7H,1-5H2;/q2*-1;+2.
What are the key properties of bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+)?
bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) has a molecular weight of 265.22 g/mol, XLogP of -1.38, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminoethyl(2-hydroxyethyl)azanide);cobalt(2+) is sourced from PubChem (CID 4026477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).