C20H27ClN2O — CID 51505536
[(3R)-1-[[1-(4-chlorophenyl)cyclopropyl]methyl]piperidin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 51505536) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is [(3R)-1-[[1-(4-chlorophenyl)cyclopropyl]methyl]piperidin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3R)-1-[[1-(4-chlorophenyl)cyclopropyl]methyl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 51505536 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(3R)-1-[[1-(4-chlorophenyl)cyclopropyl]methyl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CCCN(CC2(c3ccc(Cl)cc3)CC2)C1)N1CCCC1 |
| InChI | InChI=1S/C20H27ClN2O/c21-18-7-5-17(6-8-18)20(9-10-20)15-22-11-3-4-16(14-22)19(24)23-12-1-2-13-23/h5-8,16H,1-4,9-15H2/t16-/m1/s1 |
| InChIKey | ZIWJOVKUKYCIFZ-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |