C27H24N2O5 — CID 51507726
[2-(4-nitrophenyl)-2-oxoethyl] (3R,7S,13S,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate (PubChem CID 51507726) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] (3R,7S,13S,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] (3R,7S,13S,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 51507726 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] (3R,7S,13S,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene-10-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c3c(c1)[C@H]1C=CC[C@H]1CN3C[C@H]1CC=C[C@H]21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24N2O5/c30-25(16-7-9-20(10-8-16)29(32)33)15-34-27(31)19-11-23-21-5-1-3-17(21)13-28-14-18-4-2-6-22(18)24(12-19)26(23)28/h1-2,5-12,17-18,21-22H,3-4,13-15H2/t17-,18+,21-,22-/m0/s1 |
| InChIKey | UDSSIJUPXWYCDQ-UDKICSLYSA-N |
| XLogP | 4.79 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|