C27H21ClN2O5 — CID 51671417
[2-(4-nitrophenyl)-2-oxoethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 51671417) has the molecular formula C27H21ClN2O5 and a molecular weight of 488.93 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 51671417 |
| Molecular Formula | C27H21ClN2O5 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)[C@H]1C=CC[C@@H]1[C@H](c1ccc(Cl)cc1)N2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H21ClN2O5/c28-19-9-4-17(5-10-19)26-22-3-1-2-21(22)23-14-18(8-13-24(23)29-26)27(32)35-15-25(31)16-6-11-20(12-7-16)30(33)34/h1-2,4-14,21-22,26,29H,3,15H2/t21-,22-,26-/m0/s1 |
| InChIKey | DUHROMNKBSFBBW-MCEYFSPLSA-N |
| XLogP | 6.11 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|