C33H26ClNO3 — CID 51681704
[2-oxo-2-(4-phenylphenyl)ethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 51681704) has the molecular formula C33H26ClNO3 and a molecular weight of 520.03 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 51681704 |
| Molecular Formula | C33H26ClNO3 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] (3aS,4R,9bS)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)[C@H]1C=CC[C@@H]1[C@H](c1ccc(Cl)cc1)N2)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H26ClNO3/c34-26-16-13-24(14-17-26)32-28-8-4-7-27(28)29-19-25(15-18-30(29)35-32)33(37)38-20-31(36)23-11-9-22(10-12-23)21-5-2-1-3-6-21/h1-7,9-19,27-28,32,35H,8,20H2/t27-,28-,32-/m0/s1 |
| InChIKey | ZMJDIKXYABHSSI-HPSLPFNASA-N |
| XLogP | 7.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|