C27H21Br2NO3 — CID 98395210
[2-(4-bromophenyl)-2-oxoethyl] (3aS,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 98395210) has the molecular formula C27H21Br2NO3 and a molecular weight of 567.28 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (3aS,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (3aS,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 98395210 |
| Molecular Formula | C27H21Br2NO3 |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (3aS,4R,9bR)-4-(4-bromophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccc(Br)cc1)N2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H21Br2NO3/c28-19-9-4-16(5-10-19)25(31)15-33-27(32)18-8-13-24-23(14-18)21-2-1-3-22(21)26(30-24)17-6-11-20(29)12-7-17/h1-2,4-14,21-22,26,30H,3,15H2/t21-,22+,26+/m1/s1 |
| InChIKey | HHDNBQMRWHTRDF-UFPGJGBJSA-N |
| XLogP | 7.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|