C21H23NO5 — CID 51513036
(3R)-1-[(2S)-3-(4-ethoxyphenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-2,5-dione (PubChem CID 51513036) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is (3R)-1-[(2S)-3-(4-ethoxyphenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[(2S)-3-(4-ethoxyphenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51513036 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3R)-1-[(2S)-3-(4-ethoxyphenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(OC[C@@H](O)CN2C(=O)C[C@H](c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-2-26-17-8-10-18(11-9-17)27-14-16(23)13-22-20(24)12-19(21(22)25)15-6-4-3-5-7-15/h3-11,16,19,23H,2,12-14H2,1H3/t16-,19+/m0/s1 |
| InChIKey | CPXOKXRLQJSYBB-QFBILLFUSA-N |
| XLogP | 2.37 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|