C12H12N4S2 — CID 5151564
13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-4-thione (PubChem CID 5151564) has the molecular formula C12H12N4S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-4-thione.
| Compound Name | 13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-4-thione |
|---|---|
| PubChem CID | 5151564 |
| Molecular Formula | C12H12N4S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-4-thione |
| SMILES | CC1CCc2c(sc3ncn4[nH]c(=S)nc4c23)C1 |
| InChI | InChI=1S/C12H12N4S2/c1-6-2-3-7-8(4-6)18-11-9(7)10-14-12(17)15-16(10)5-13-11/h5-6H,2-4H2,1H3,(H,15,17) |
| InChIKey | IBAXEGOETZJWKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|