C21H16N2O6 — CID 5151856
[3-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 5151856) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is [3-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [3-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5151856 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [3-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1cccc(C=NNC(=O)C2COc3ccccc3O2)c1)c1ccco1 |
| InChI | InChI=1S/C21H16N2O6/c24-20(19-13-27-16-7-1-2-8-17(16)29-19)23-22-12-14-5-3-6-15(11-14)28-21(25)18-9-4-10-26-18/h1-12,19H,13H2,(H,23,24) |
| InChIKey | RGPGXXHTMWWVIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|