C23H28N2OS — CID 51520070
(4R)-2-hexylsulfanyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile (PubChem CID 51520070) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is (4R)-2-hexylsulfanyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile.
| Compound Name | (4R)-2-hexylsulfanyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 51520070 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (4R)-2-hexylsulfanyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile |
| SMILES | CCCCCCSC1=C(C#N)[C@H](c2ccc(C)cc2)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C23H28N2OS/c1-3-4-5-6-14-27-23-18(15-24)21(17-12-10-16(2)11-13-17)22-19(25-23)8-7-9-20(22)26/h10-13,21,25H,3-9,14H2,1-2H3/t21-/m0/s1 |
| InChIKey | HMFCWRBZGPZMBQ-NRFANRHFSA-N |
| XLogP | 5.74 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|