C25H27N3O6 — CID 51523205
5-ethyl-N-[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxamide (PubChem CID 51523205) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 5-ethyl-N-[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxamide.
| Compound Name | 5-ethyl-N-[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 51523205 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-ethyl-N-[(2R)-1-(3-hydroxypropylamino)-1-oxo-3-phenylpropan-2-yl]-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxamide |
| SMILES | CCn1cc(C(=O)N[C@H](Cc2ccccc2)C(=O)NCCCO)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C25H27N3O6/c1-2-28-14-18(23(30)17-12-21-22(13-20(17)28)34-15-33-21)24(31)27-19(25(32)26-9-6-10-29)11-16-7-4-3-5-8-16/h3-5,7-8,12-14,19,29H,2,6,9-11,15H2,1H3,(H,26,32)(H,27,31)/t19-/m1/s1 |
| InChIKey | VBMQAIDCTYNDRQ-LJQANCHMSA-N |
| XLogP | 1.59 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|