C23H20N4O3S — CID 51524222
(3R)-3-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-(4-ethylphenyl)pyrrolidine-2,5-dione (PubChem CID 51524222) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is (3R)-3-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-(4-ethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-(4-ethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51524222 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (3R)-3-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-1-(4-ethylphenyl)pyrrolidine-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@H](c3c(C)[nH]n(-c4nc5ccccc5s4)c3=O)C2=O)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-3-14-8-10-15(11-9-14)26-19(28)12-16(21(26)29)20-13(2)25-27(22(20)30)23-24-17-6-4-5-7-18(17)31-23/h4-11,16,25H,3,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | DTEOAPYOBULKDK-MRXNPFEDSA-N |
| XLogP | 3.69 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|