C19H22N6 — CID 5152494
1-(2,5-dimethylphenyl)-4-(1-phenyltetrazol-5-yl)piperazine (PubChem CID 5152494) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-(1-phenyltetrazol-5-yl)piperazine.
| Compound Name | 1-(2,5-dimethylphenyl)-4-(1-phenyltetrazol-5-yl)piperazine |
|---|---|
| PubChem CID | 5152494 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-(1-phenyltetrazol-5-yl)piperazine |
| SMILES | Cc1ccc(C)c(N2CCN(c3nnnn3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H22N6/c1-15-8-9-16(2)18(14-15)23-10-12-24(13-11-23)19-20-21-22-25(19)17-6-4-3-5-7-17/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | JEMZTFFTDNRKRS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |