C20H25NO — CID 51526999
(2R)-4-phenyl-N-[(4-prop-2-enoxyphenyl)methyl]butan-2-amine (PubChem CID 51526999) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (2R)-4-phenyl-N-[(4-prop-2-enoxyphenyl)methyl]butan-2-amine.
| Compound Name | (2R)-4-phenyl-N-[(4-prop-2-enoxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 51526999 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2R)-4-phenyl-N-[(4-prop-2-enoxyphenyl)methyl]butan-2-amine |
| SMILES | C=CCOc1ccc(CN[C@H](C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO/c1-3-15-22-20-13-11-19(12-14-20)16-21-17(2)9-10-18-7-5-4-6-8-18/h3-8,11-14,17,21H,1,9-10,15-16H2,2H3/t17-/m1/s1 |
| InChIKey | WUDLMIJVZBXQDI-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|