C26H30N2O2 — CID 51991185
N-(4-methylphenyl)-2-[4-[[[(2S)-4-phenylbutan-2-yl]amino]methyl]phenoxy]acetamide (PubChem CID 51991185) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[[[(2S)-4-phenylbutan-2-yl]amino]methyl]phenoxy]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[[[(2S)-4-phenylbutan-2-yl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 51991185 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[[[(2S)-4-phenylbutan-2-yl]amino]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(CN[C@@H](C)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-20-8-14-24(15-9-20)28-26(29)19-30-25-16-12-23(13-17-25)18-27-21(2)10-11-22-6-4-3-5-7-22/h3-9,12-17,21,27H,10-11,18-19H2,1-2H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | GYYUCCJZKMBHQJ-NRFANRHFSA-N |
| XLogP | 5.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |