C21H28N2O — CID 8002682
(2S)-2-[(4-methylphenyl)methylamino]-N-[(2R)-4-phenylbutan-2-yl]propanamide (PubChem CID 8002682) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (2S)-2-[(4-methylphenyl)methylamino]-N-[(2R)-4-phenylbutan-2-yl]propanamide.
| Compound Name | (2S)-2-[(4-methylphenyl)methylamino]-N-[(2R)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 8002682 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (2S)-2-[(4-methylphenyl)methylamino]-N-[(2R)-4-phenylbutan-2-yl]propanamide |
| SMILES | Cc1ccc(CN[C@@H](C)C(=O)N[C@H](C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-16-9-12-20(13-10-16)15-22-18(3)21(24)23-17(2)11-14-19-7-5-4-6-8-19/h4-10,12-13,17-18,22H,11,14-15H2,1-3H3,(H,23,24)/t17-,18+/m1/s1 |
| InChIKey | AOCYPHLCTCQHHF-MSOLQXFVSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |