C25H17FN2O4S — CID 5154006
1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5154006) has the molecular formula C25H17FN2O4S and a molecular weight of 460.49 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5154006 |
| Molecular Formula | C25H17FN2O4S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(c3nc4ccc(F)cc4s3)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C25H17FN2O4S/c1-13-5-7-14(8-6-13)22(30)20-21(15-3-2-4-17(29)11-15)28(24(32)23(20)31)25-27-18-10-9-16(26)12-19(18)33-25/h2-12,21,29-30H,1H3 |
| InChIKey | ZQYZBSYRXLYKKP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|