C18H26N2O2S2 — CID 5155336
methyl 2-[(2-ethylpiperidine-1-carbothioyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5155336) has the molecular formula C18H26N2O2S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is methyl 2-[(2-ethylpiperidine-1-carbothioyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-ethylpiperidine-1-carbothioyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5155336 |
| Molecular Formula | C18H26N2O2S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl 2-[(2-ethylpiperidine-1-carbothioyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC1CCCCN1C(=S)Nc1sc2c(c1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C18H26N2O2S2/c1-3-12-8-6-7-11-20(12)18(23)19-16-15(17(21)22-2)13-9-4-5-10-14(13)24-16/h12H,3-11H2,1-2H3,(H,19,23) |
| InChIKey | ZUGDGUHXNLNAFP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|