C19H16BrN3O5 — CID 5155452
methyl 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate (PubChem CID 5155452) has the molecular formula C19H16BrN3O5 and a molecular weight of 446.26 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate.
| Compound Name | methyl 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 5155452 |
| Molecular Formula | C19H16BrN3O5 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | methyl 2-[4-bromo-2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(Br)cc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C19H16BrN3O5/c1-11(18(25)27-2)28-16-8-7-13(20)9-12(16)10-21-23-17(24)14-5-3-4-6-15(14)22-19(23)26/h3-11H,1-2H3,(H,22,26) |
| InChIKey | DISRKYRDRQELQT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|