C14H15NO4S — CID 51567261
2-[(S)-furan-2-yl-(2-methoxyanilino)methyl]sulfanylacetic acid (PubChem CID 51567261) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[(S)-furan-2-yl-(2-methoxyanilino)methyl]sulfanylacetic acid.
| Compound Name | 2-[(S)-furan-2-yl-(2-methoxyanilino)methyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 51567261 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[(S)-furan-2-yl-(2-methoxyanilino)methyl]sulfanylacetic acid |
| SMILES | COc1ccccc1N[C@@H](SCC(=O)O)c1ccco1 |
| InChI | InChI=1S/C14H15NO4S/c1-18-11-6-3-2-5-10(11)15-14(20-9-13(16)17)12-7-4-8-19-12/h2-8,14-15H,9H2,1H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | KDEVGEHMRQTNGC-AWEZNQCLSA-N |
| XLogP | 3.22 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|