C20H19BrN4O3S — CID 51578176
[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-(4-methoxyphenyl)ethylideneamino]carbamimidothioate (PubChem CID 51578176) has the molecular formula C20H19BrN4O3S and a molecular weight of 475.37 g/mol. Its IUPAC name is [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-(4-methoxyphenyl)ethylideneamino]carbamimidothioate.
| Compound Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-(4-methoxyphenyl)ethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 51578176 |
| Molecular Formula | C20H19BrN4O3S |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-(4-methoxyphenyl)ethylideneamino]carbamimidothioate |
| SMILES | COc1ccc(/C(C)=N\N=C(N)S[C@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19BrN4O3S/c1-12(13-3-9-16(28-2)10-4-13)23-24-20(22)29-17-11-18(26)25(19(17)27)15-7-5-14(21)6-8-15/h3-10,17H,11H2,1-2H3,(H2,22,24)/b23-12-/t17-/m0/s1 |
| InChIKey | MLJRIXMLTIBUPP-QWUOEIFBSA-N |
| XLogP | 3.56 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|