C28H26N2O7 — CID 51579042
ethyl 4-[(3R,3aR,6aS)-3-(2,4-dimethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 51579042) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is ethyl 4-[(3R,3aR,6aS)-3-(2,4-dimethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 4-[(3R,3aR,6aS)-3-(2,4-dimethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 51579042 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | ethyl 4-[(3R,3aR,6aS)-3-(2,4-dimethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](ON(c4ccccc4)[C@H]3c3ccc(OC)cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C28H26N2O7/c1-4-36-28(33)17-10-12-18(13-11-17)29-26(31)23-24(21-15-14-20(34-2)16-22(21)35-3)30(37-25(23)27(29)32)19-8-6-5-7-9-19/h5-16,23-25H,4H2,1-3H3/t23-,24+,25+/m1/s1 |
| InChIKey | NYIWAIRPVICZMQ-DSITVLBTSA-N |
| XLogP | 3.93 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|