C26H27N3O2S — CID 5157936
1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylethanone (PubChem CID 5157936) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylethanone.
| Compound Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 5157936 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-[1-(4-ethoxyphenyl)benzimidazol-2-yl]sulfanylethanone |
| SMILES | C=CCn1c(C)cc(C(=O)CSc2nc3ccccc3n2-c2ccc(OCC)cc2)c1C |
| InChI | InChI=1S/C26H27N3O2S/c1-5-15-28-18(3)16-22(19(28)4)25(30)17-32-26-27-23-9-7-8-10-24(23)29(26)20-11-13-21(14-12-20)31-6-2/h5,7-14,16H,1,6,15,17H2,2-4H3 |
| InChIKey | IZDJBOKUJWIOTJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|