C20H18N2O4S — CID 51583917
(2R)-2-(1,3-benzodioxol-5-yloxy)-N-(5-benzyl-1,3-thiazol-2-yl)propanamide (PubChem CID 51583917) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-5-yloxy)-N-(5-benzyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | (2R)-2-(1,3-benzodioxol-5-yloxy)-N-(5-benzyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 51583917 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-yloxy)-N-(5-benzyl-1,3-thiazol-2-yl)propanamide |
| SMILES | C[C@@H](Oc1ccc2c(c1)OCO2)C(=O)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C20H18N2O4S/c1-13(26-15-7-8-17-18(10-15)25-12-24-17)19(23)22-20-21-11-16(27-20)9-14-5-3-2-4-6-14/h2-8,10-11,13H,9,12H2,1H3,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | AHQKLIPHWHFTDD-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |