About N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide
N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide (PubChem CID 51585948) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide |
| PubChem CID | 51585948 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide |
| SMILES | Cc1ccc([C@H](NC(=O)c2ccnc(N3CCOCC3)c2)c2ccncc2)cc1C |
| InChI | InChI=1S/C24H26N4O2/c1-17-3-4-20(15-18(17)2)23(19-5-8-25-9-6-19)27-24(29)21-7-10-26-22(16-21)28-11-13-30-14-12-28/h3-10,15-16,23H,11-14H2,1-2H3,(H,27,29)/t23-/m1/s1 |
| InChIKey | NFFRAOJDSUFVIU-HSZRJFAPSA-N |
| XLogP | 3.45 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide?
The IUPAC name of N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide (CID 51585948) is N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide.
What is the SMILES notation for N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide?
The canonical SMILES for N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide is Cc1ccc([C@H](NC(=O)c2ccnc(N3CCOCC3)c2)c2ccncc2)cc1C.
What is the InChIKey of N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide?
The InChIKey is NFFRAOJDSUFVIU-HSZRJFAPSA-N. The full InChI is InChI=1S/C24H26N4O2/c1-17-3-4-20(15-18(17)2)23(19-5-8-25-9-6-19)27-24(29)21-7-10-26-22(16-21)28-11-13-30-14-12-28/h3-10,15-16,23H,11-14H2,1-2H3,(H,27,29)/t23-/m1/s1.
What are the key properties of N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide?
N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide has a molecular weight of 402.50 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(S)-(3,4-dimethylphenyl)-pyridin-4-ylmethyl]-2-morpholin-4-ylpyridine-4-carboxamide is sourced from PubChem (CID 51585948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).