C20H24N4O2S — CID 51590916
(3R)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 51590916) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is (3R)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51590916 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3R)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-5-oxo-1-(pyridin-4-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCCCC2)[C@@H]1CC(=O)N(Cc2ccncc2)C1 |
| InChI | InChI=1S/C20H24N4O2S/c25-18-11-15(13-24(18)12-14-7-9-21-10-8-14)19(26)23-20-22-16-5-3-1-2-4-6-17(16)27-20/h7-10,15H,1-6,11-13H2,(H,22,23,26)/t15-/m1/s1 |
| InChIKey | LOFOZZPVWFQXSC-OAHLLOKOSA-N |
| XLogP | 3.18 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |