C21H23NO2 — CID 515980
5-[3-(2,6-dimethyl-4-phenylphenoxy)propyl]-3-methyl-1,2-oxazole (PubChem CID 515980) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-[3-(2,6-dimethyl-4-phenylphenoxy)propyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[3-(2,6-dimethyl-4-phenylphenoxy)propyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 515980 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 5-[3-(2,6-dimethyl-4-phenylphenoxy)propyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3ccccc3)cc2C)on1 |
| InChI | InChI=1S/C21H23NO2/c1-15-12-19(18-8-5-4-6-9-18)13-16(2)21(15)23-11-7-10-20-14-17(3)22-24-20/h4-6,8-9,12-14H,7,10-11H2,1-3H3 |
| InChIKey | AZIPAVAEKCTJBC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|