About 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole
5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole (PubChem CID 515981) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole |
| PubChem CID | 515981 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cccc(-c2cc(C)c(OCCCc3cc(C)no3)c(C)c2)c1 |
| InChI | InChI=1S/C22H25NO2/c1-15-7-5-8-19(11-15)20-12-16(2)22(17(3)13-20)24-10-6-9-21-14-18(4)23-25-21/h5,7-8,11-14H,6,9-10H2,1-4H3 |
| InChIKey | VXGLCWZHWYFUBF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole (CID 515981) is 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole is Cc1cccc(-c2cc(C)c(OCCCc3cc(C)no3)c(C)c2)c1.
What is the InChIKey of 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole?
The InChIKey is VXGLCWZHWYFUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO2/c1-15-7-5-8-19(11-15)20-12-16(2)22(17(3)13-20)24-10-6-9-21-14-18(4)23-25-21/h5,7-8,11-14H,6,9-10H2,1-4H3.
What are the key properties of 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole?
5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole has a molecular weight of 335.45 g/mol, XLogP of 5.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[2,6-dimethyl-4-(3-methylphenyl)phenoxy]propyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 515981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).