C22H25NO3 — CID 515984
5-[3-[4-(4-methoxyphenyl)-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole (PubChem CID 515984) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-[3-[4-(4-methoxyphenyl)-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[3-[4-(4-methoxyphenyl)-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 515984 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 5-[3-[4-(4-methoxyphenyl)-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(C)c(OCCCc3cc(C)no3)c(C)c2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-15-12-19(18-7-9-20(24-4)10-8-18)13-16(2)22(15)25-11-5-6-21-14-17(3)23-26-21/h7-10,12-14H,5-6,11H2,1-4H3 |
| InChIKey | USENBSHPIYEUGB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|