C19H27N3O4S — CID 51598559
3-methyl-N-[2-[[(2R)-oxan-2-yl]methoxy]phenyl]-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 51598559) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-methyl-N-[2-[[(2R)-oxan-2-yl]methoxy]phenyl]-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-methyl-N-[2-[[(2R)-oxan-2-yl]methoxy]phenyl]-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 51598559 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-methyl-N-[2-[[(2R)-oxan-2-yl]methoxy]phenyl]-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)C)cc1S(=O)(=O)Nc1ccccc1OC[C@H]1CCCCO1 |
| InChI | InChI=1S/C19H27N3O4S/c1-14(2)22-12-19(15(3)20-22)27(23,24)21-17-9-4-5-10-18(17)26-13-16-8-6-7-11-25-16/h4-5,9-10,12,14,16,21H,6-8,11,13H2,1-3H3/t16-/m1/s1 |
| InChIKey | VPRGXBUWFVEJJL-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |