C23H28N2O4 — CID 86835563
N-[4-[2-(oxan-2-ylmethoxy)anilino]-4-oxobutan-2-yl]benzamide (PubChem CID 86835563) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-[2-(oxan-2-ylmethoxy)anilino]-4-oxobutan-2-yl]benzamide.
| Compound Name | N-[4-[2-(oxan-2-ylmethoxy)anilino]-4-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 86835563 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[4-[2-(oxan-2-ylmethoxy)anilino]-4-oxobutan-2-yl]benzamide |
| SMILES | CC(CC(=O)Nc1ccccc1OCC1CCCCO1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-17(24-23(27)18-9-3-2-4-10-18)15-22(26)25-20-12-5-6-13-21(20)29-16-19-11-7-8-14-28-19/h2-6,9-10,12-13,17,19H,7-8,11,14-16H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | LBAHSAKJYAOSNT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |